C11H22O4Si — CID 11746945
(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-one (PubChem CID 11746945) has the molecular formula C11H22O4Si and a molecular weight of 246.38 g/mol. Its IUPAC name is (4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-one.
| Compound Name | (4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 11746945 |
| Molecular Formula | C11H22O4Si |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)C[C@H]1O |
| InChI | InChI=1S/C11H22O4Si/c1-11(2,3)16(4,5)14-7-9-8(12)6-10(13)15-9/h8-9,12H,6-7H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | SDCFTMGYNDVBRM-RKDXNWHRSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|