C17H34F2O6Si2 — CID 54307141
(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-one (PubChem CID 54307141) has the molecular formula C17H34F2O6Si2 and a molecular weight of 428.62 g/mol. Its IUPAC name is (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-one.
| Compound Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 54307141 |
| Molecular Formula | C17H34F2O6Si2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(O)[C@H]1OC(=O)C(F)(F)[C@@]1(O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34F2O6Si2/c1-14(2,3)26(7,8)24-12(20)11-17(22,16(18,19)13(21)23-11)25-27(9,10)15(4,5)6/h11-12,20,22H,1-10H3/t11-,12?,17+/m1/s1 |
| InChIKey | SIHVGLOMKDFOHE-AURTYUHDSA-N |
| XLogP | 3.60 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|