C17H34F2O4Si2 — CID 58946409
(5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluorooxolan-2-one (PubChem CID 58946409) has the molecular formula C17H34F2O4Si2 and a molecular weight of 396.62 g/mol. Its IUPAC name is (5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluorooxolan-2-one.
| Compound Name | (5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 58946409 |
| Molecular Formula | C17H34F2O4Si2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-difluorooxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)C(F)(F)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34F2O4Si2/c1-15(2,3)24(7,8)21-11-12-13(17(18,19)14(20)22-12)23-25(9,10)16(4,5)6/h12-13H,11H2,1-10H3/t12-,13?/m1/s1 |
| InChIKey | JONRJZJEVOTNKZ-PZORYLMUSA-N |
| XLogP | 4.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|