C17H34ClFO4Si2 — CID 135396109
(3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-3-fluorooxolan-2-one (PubChem CID 135396109) has the molecular formula C17H34ClFO4Si2 and a molecular weight of 413.08 g/mol. Its IUPAC name is (3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-3-fluorooxolan-2-one.
| Compound Name | (3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-3-fluorooxolan-2-one |
|---|---|
| PubChem CID | 135396109 |
| Molecular Formula | C17H34ClFO4Si2 |
| Molecular Weight | 413.08 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-3-fluorooxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)[C@@](F)(Cl)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34ClFO4Si2/c1-15(2,3)24(7,8)21-11-12-13(17(18,19)14(20)22-12)23-25(9,10)16(4,5)6/h12-13H,11H2,1-10H3/t12-,13-,17-/m1/s1 |
| InChIKey | ODJFXQKCKVGCGD-PBFPGSCMSA-N |
| XLogP | 5.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.08 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|