C16H26O2 — CID 11747077
(1S,7aS)-4,4,7a-trimethyl-1-[(2-methylpropan-2-yl)oxy]-1,2,6,7-tetrahydroinden-5-one (PubChem CID 11747077) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1S,7aS)-4,4,7a-trimethyl-1-[(2-methylpropan-2-yl)oxy]-1,2,6,7-tetrahydroinden-5-one.
| Compound Name | (1S,7aS)-4,4,7a-trimethyl-1-[(2-methylpropan-2-yl)oxy]-1,2,6,7-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 11747077 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1S,7aS)-4,4,7a-trimethyl-1-[(2-methylpropan-2-yl)oxy]-1,2,6,7-tetrahydroinden-5-one |
| SMILES | CC(C)(C)O[C@H]1CC=C2C(C)(C)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C16H26O2/c1-14(2,3)18-13-8-7-11-15(4,5)12(17)9-10-16(11,13)6/h7,13H,8-10H2,1-6H3/t13-,16-/m0/s1 |
| InChIKey | UFWAOGNNWXUECR-BBRMVZONSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|