C16H18ClNO2 — CID 117471253
1-(5-chloro-2-methyl-1H-indol-6-yl)cyclohexane-1-carboxylic acid (PubChem CID 117471253) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methyl-1H-indol-6-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(5-chloro-2-methyl-1H-indol-6-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117471253 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-(5-chloro-2-methyl-1H-indol-6-yl)cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc2cc(Cl)c(C3(C(=O)O)CCCCC3)cc2[nH]1 |
| InChI | InChI=1S/C16H18ClNO2/c1-10-7-11-8-13(17)12(9-14(11)18-10)16(15(19)20)5-3-2-4-6-16/h7-9,18H,2-6H2,1H3,(H,19,20) |
| InChIKey | XZXFXXWDLPVEDZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |