C13H17F2NSi — CID 11747154
(4,4-difluoro-5-phenyl-2,3-dihydropyrrol-2-yl)-trimethylsilane (PubChem CID 11747154) has the molecular formula C13H17F2NSi and a molecular weight of 253.37 g/mol. Its IUPAC name is (4,4-difluoro-5-phenyl-2,3-dihydropyrrol-2-yl)-trimethylsilane.
| Compound Name | (4,4-difluoro-5-phenyl-2,3-dihydropyrrol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 11747154 |
| Molecular Formula | C13H17F2NSi |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (4,4-difluoro-5-phenyl-2,3-dihydropyrrol-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1CC(F)(F)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C13H17F2NSi/c1-17(2,3)11-9-13(14,15)12(16-11)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3 |
| InChIKey | HRUKVNSLLWDFCX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|