C11H12FN — CID 102142893
5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole (PubChem CID 102142893) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 102142893 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole |
| SMILES | CC1CCC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C11H12FN/c1-8-2-7-11(13-8)9-3-5-10(12)6-4-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | XHWLGVSCNFGESB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |