C14H17FN4O2 — CID 117471970
tert-butyl N-[5-(3-amino-1H-pyrazol-5-yl)-2-fluorophenyl]carbamate (PubChem CID 117471970) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is tert-butyl N-[5-(3-amino-1H-pyrazol-5-yl)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(3-amino-1H-pyrazol-5-yl)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 117471970 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | tert-butyl N-[5-(3-amino-1H-pyrazol-5-yl)-2-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(-c2cc(N)n[nH]2)ccc1F |
| InChI | InChI=1S/C14H17FN4O2/c1-14(2,3)21-13(20)17-11-6-8(4-5-9(11)15)10-7-12(16)19-18-10/h4-7H,1-3H3,(H,17,20)(H3,16,18,19) |
| InChIKey | NGWGHQSYVXOOAQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |