C14H20N2O4 — CID 11747944
(3S,6R)-1,4-diacetyl-3-propan-2-yl-6-prop-2-enylpiperazine-2,5-dione (PubChem CID 11747944) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3S,6R)-1,4-diacetyl-3-propan-2-yl-6-prop-2-enylpiperazine-2,5-dione.
| Compound Name | (3S,6R)-1,4-diacetyl-3-propan-2-yl-6-prop-2-enylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 11747944 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (3S,6R)-1,4-diacetyl-3-propan-2-yl-6-prop-2-enylpiperazine-2,5-dione |
| SMILES | C=CC[C@@H]1C(=O)N(C(C)=O)[C@@H](C(C)C)C(=O)N1C(C)=O |
| InChI | InChI=1S/C14H20N2O4/c1-6-7-11-13(19)16(10(5)18)12(8(2)3)14(20)15(11)9(4)17/h6,8,11-12H,1,7H2,2-5H3/t11-,12+/m1/s1 |
| InChIKey | UEUZXYLUULLXKX-NEPJUHHUSA-N |
| XLogP | 0.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|