C12H14FNO5S — CID 117488295
5-(2-fluoro-4-hydroxy-3-methylsulfonylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117488295) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is 5-(2-fluoro-4-hydroxy-3-methylsulfonylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(2-fluoro-4-hydroxy-3-methylsulfonylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117488295 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-(2-fluoro-4-hydroxy-3-methylsulfonylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CS(=O)(=O)c1c(O)ccc(C2CC(C(=O)O)CN2)c1F |
| InChI | InChI=1S/C12H14FNO5S/c1-20(18,19)11-9(15)3-2-7(10(11)13)8-4-6(5-14-8)12(16)17/h2-3,6,8,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | WPNJLVHBFKBHGS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |