C10H9BrO4S — CID 117490348
3-bromo-4-(1,1-dioxothietan-3-yl)oxybenzaldehyde (PubChem CID 117490348) has the molecular formula C10H9BrO4S and a molecular weight of 305.15 g/mol. Its IUPAC name is 3-bromo-4-(1,1-dioxothietan-3-yl)oxybenzaldehyde.
| Compound Name | 3-bromo-4-(1,1-dioxothietan-3-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 117490348 |
| Molecular Formula | C10H9BrO4S |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | 3-bromo-4-(1,1-dioxothietan-3-yl)oxybenzaldehyde |
| SMILES | O=Cc1ccc(OC2CS(=O)(=O)C2)c(Br)c1 |
| InChI | InChI=1S/C10H9BrO4S/c11-9-3-7(4-12)1-2-10(9)15-8-5-16(13,14)6-8/h1-4,8H,5-6H2 |
| InChIKey | SIMDHQBBWKGUOX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|