C20H22O7 — CID 11749149
5,7-bis(methoxymethoxy)-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 11749149) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 5,7-bis(methoxymethoxy)-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5,7-bis(methoxymethoxy)-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 11749149 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 5,7-bis(methoxymethoxy)-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COCOc1cc(OCOC)c2c(c1)OCC(c1ccc(OC)cc1)C2=O |
| InChI | InChI=1S/C20H22O7/c1-22-11-26-15-8-17-19(18(9-15)27-12-23-2)20(21)16(10-25-17)13-4-6-14(24-3)7-5-13/h4-9,16H,10-12H2,1-3H3 |
| InChIKey | ZUEXWEDLJBVOHM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|