C20H19N3O6 — CID 11749855
[(2R,4aR,6S,7R,8R,8aS)-7-azido-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate (PubChem CID 11749855) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aS)-7-azido-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aS)-7-azido-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate |
|---|---|
| PubChem CID | 11749855 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aS)-7-azido-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](OC(=O)c2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C20H19N3O6/c21-23-22-15-16(24)17-14(11-26-19(28-17)13-9-5-2-6-10-13)27-20(15)29-18(25)12-7-3-1-4-8-12/h1-10,14-17,19-20,24H,11H2/t14-,15-,16-,17-,19-,20+/m1/s1 |
| InChIKey | GCVLCGJLKSTICJ-HZLBELHRSA-N |
| XLogP | 2.72 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|