C23H40O6 — CID 11750278
methyl (5Z,8S,9R,10E)-8-acetyl-9-(dimethoxymethyl)-12-hydroxyheptadeca-5,10-dienoate (PubChem CID 11750278) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is methyl (5Z,8S,9R,10E)-8-acetyl-9-(dimethoxymethyl)-12-hydroxyheptadeca-5,10-dienoate.
| Compound Name | methyl (5Z,8S,9R,10E)-8-acetyl-9-(dimethoxymethyl)-12-hydroxyheptadeca-5,10-dienoate |
|---|---|
| PubChem CID | 11750278 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | methyl (5Z,8S,9R,10E)-8-acetyl-9-(dimethoxymethyl)-12-hydroxyheptadeca-5,10-dienoate |
| SMILES | CCCCCC(O)/C=C/[C@@H](C(OC)OC)[C@H](C/C=C\CCCC(=O)OC)C(C)=O |
| InChI | InChI=1S/C23H40O6/c1-6-7-10-13-19(25)16-17-21(23(28-4)29-5)20(18(2)24)14-11-8-9-12-15-22(26)27-3/h8,11,16-17,19-21,23,25H,6-7,9-10,12-15H2,1-5H3/b11-8-,17-16+/t19?,20-,21-/m1/s1 |
| InChIKey | COCFFPWBCDZPEC-KPAUHWIDSA-N |
| XLogP | 4.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|