C21H24F3NO6 — CID 11751118
[(5R,8S,9R)-9-acetamido-2,2-dimethyl-1,3-dioxaspiro[4.4]non-6-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11751118) has the molecular formula C21H24F3NO6 and a molecular weight of 443.42 g/mol. Its IUPAC name is [(5R,8S,9R)-9-acetamido-2,2-dimethyl-1,3-dioxaspiro[4.4]non-6-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(5R,8S,9R)-9-acetamido-2,2-dimethyl-1,3-dioxaspiro[4.4]non-6-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11751118 |
| Molecular Formula | C21H24F3NO6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [(5R,8S,9R)-9-acetamido-2,2-dimethyl-1,3-dioxaspiro[4.4]non-6-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@H]1C=C[C@]2(COC(C)(C)O2)[C@@H]1NC(C)=O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H24F3NO6/c1-13(26)25-16-15(10-11-19(16)12-29-18(2,3)31-19)30-17(27)20(28-4,21(22,23)24)14-8-6-5-7-9-14/h5-11,15-16H,12H2,1-4H3,(H,25,26)/t15-,16+,19-,20-/m0/s1 |
| InChIKey | BJAOWDVZSJTKJO-JSJNYSNDSA-N |
| XLogP | 2.60 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|