C22H28BF5N2O3 — CID 11751836
[(S)-[(2R,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate tetrafluoroborate (PubChem CID 11751836) has the molecular formula C22H28BF5N2O3 and a molecular weight of 474.28 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate tetrafluoroborate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate tetrafluoroborate |
|---|---|
| PubChem CID | 11751836 |
| Molecular Formula | C22H28BF5N2O3 |
| Molecular Weight | 474.28 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] acetate tetrafluoroborate |
| SMILES | CC[C@H]1C[N+]2(F)CC[C@H]1C[C@@H]2[C@@H](OC(C)=O)c1ccnc2ccc(OC)cc12.F[B-](F)(F)F |
| InChI | InChI=1S/C22H28FN2O3.BF4/c1-4-15-13-25(23)10-8-16(15)11-21(25)22(28-14(2)26)18-7-9-24-20-6-5-17(27-3)12-19(18)20;2-1(3,4)5/h5-7,9,12,15-16,21-22H,4,8,10-11,13H2,1-3H3;/q+1;-1/t15-,16-,21+,22-,25?;/m0./s1 |
| InChIKey | SRFFHHNCISIKHR-LZTQBMISSA-N |
| XLogP | 5.67 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.28 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|