C20H26FN2O2+ — CID 177422827
(R)-[(1R,2S,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 177422827) has the molecular formula C20H26FN2O2+ and a molecular weight of 345.44 g/mol. Its IUPAC name is (R)-[(1R,2S,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(1R,2S,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 177422827 |
| Molecular Formula | C20H26FN2O2+ |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | (R)-[(1R,2S,4S,5R)-5-ethyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | CC[C@H]1C[N@+]2(F)CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H26FN2O2/c1-3-13-12-23(21)9-7-14(13)10-19(23)20(24)16-6-8-22-18-5-4-15(25-2)11-17(16)18/h4-6,8,11,13-14,19-20,24H,3,7,9-10,12H2,1-2H3/q+1/t13-,14-,19-,20+,23+/m0/s1 |
| InChIKey | KNLRGDWBYQXLIN-JTPGJWQASA-N |
| XLogP | 3.80 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|