C20H26N3O2+ — CID 134123129
(1-amino-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol (PubChem CID 134123129) has the molecular formula C20H26N3O2+ and a molecular weight of 340.45 g/mol. Its IUPAC name is (1-amino-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (1-amino-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 134123129 |
| Molecular Formula | C20H26N3O2+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1-amino-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(N)CCC1CC2C(O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H26N3O2/c1-3-13-12-23(21)9-7-14(13)10-19(23)20(24)16-6-8-22-18-5-4-15(25-2)11-17(16)18/h3-6,8,11,13-14,19-20,24H,1,7,9-10,12,21H2,2H3/q+1 |
| InChIKey | LUTYOFJKVGEUQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|