C25H35N2O2+ — CID 3033236
(S)-[(2S)-5-ethenyl-1-(3-methylbutyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 3033236) has the molecular formula C25H35N2O2+ and a molecular weight of 395.57 g/mol. Its IUPAC name is (S)-[(2S)-5-ethenyl-1-(3-methylbutyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (S)-[(2S)-5-ethenyl-1-(3-methylbutyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 3033236 |
| Molecular Formula | C25H35N2O2+ |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (S)-[(2S)-5-ethenyl-1-(3-methylbutyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C[N+]2(CCC(C)C)CCC1C[C@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C25H35N2O2/c1-5-18-16-27(12-9-17(2)3)13-10-19(18)14-24(27)25(28)21-8-11-26-23-7-6-20(29-4)15-22(21)23/h5-8,11,15,17-19,24-25,28H,1,9-10,12-14,16H2,2-4H3/q+1/t18?,19?,24-,25-,27?/m0/s1 |
| InChIKey | RSMUQGYUMZHRNE-ZRCLBZFHSA-N |
| XLogP | 4.73 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|