C28H30BF5N2O4 — CID 134991271
[(R)-[(1R,2S,4S,5R)-5-ethenyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate tetrafluoroborate (PubChem CID 134991271) has the molecular formula C28H30BF5N2O4 and a molecular weight of 564.36 g/mol. Its IUPAC name is [(R)-[(1R,2S,4S,5R)-5-ethenyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate tetrafluoroborate.
| Compound Name | [(R)-[(1R,2S,4S,5R)-5-ethenyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate tetrafluoroborate |
|---|---|
| PubChem CID | 134991271 |
| Molecular Formula | C28H30BF5N2O4 |
| Molecular Weight | 564.36 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(R)-[(1R,2S,4S,5R)-5-ethenyl-1-fluoro-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-methoxybenzoate tetrafluoroborate |
| SMILES | C=C[C@H]1C[N@+]2(F)CC[C@H]1C[C@H]2[C@H](OC(=O)c1ccc(OC)cc1)c1ccnc2ccc(OC)cc12.F[B-](F)(F)F |
| InChI | InChI=1S/C28H30FN2O4.BF4/c1-4-18-17-31(29)14-12-20(18)15-26(31)27(35-28(32)19-5-7-21(33-2)8-6-19)23-11-13-30-25-10-9-22(34-3)16-24(23)25;2-1(3,4)5/h4-11,13,16,18,20,26-27H,1,12,14-15,17H2,2-3H3;/q+1;-1/t18-,20-,26-,27+,31+;/m0./s1 |
| InChIKey | WLOFDMUXIQRBKG-ICZFSUFTSA-N |
| XLogP | 6.75 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.36 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|