C28H30BrN2O3+ — CID 124909777
1-(4-bromophenyl)-2-[(1S,2R,4S,5S)-5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanone (PubChem CID 124909777) has the molecular formula C28H30BrN2O3+ and a molecular weight of 522.46 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[(1S,2R,4S,5S)-5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[(1S,2R,4S,5S)-5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanone |
|---|---|
| PubChem CID | 124909777 |
| Molecular Formula | C28H30BrN2O3+ |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 1-(4-bromophenyl)-2-[(1S,2R,4S,5S)-5-ethenyl-2-[(R)-hydroxy-(6-methoxyquinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanone |
| SMILES | C=C[C@@H]1C[N@+]2(CC(=O)c3ccc(Br)cc3)CC[C@H]1C[C@@H]2[C@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H30BrN2O3/c1-3-18-16-31(17-27(32)19-4-6-21(29)7-5-19)13-11-20(18)14-26(31)28(33)23-10-12-30-25-9-8-22(34-2)15-24(23)25/h3-10,12,15,18,20,26,28,33H,1,11,13-14,16-17H2,2H3/q+1/t18-,20+,26-,28-,31+/m1/s1 |
| InChIKey | QVGBTFSFWBDYCG-NPBPBAIISA-N |
| XLogP | 5.33 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|