C26H50O7Si — CID 11752426
2-[(2R,3S,4S,6R)-6-[(4R,5S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methyloxan-2-yl]ethanol (PubChem CID 11752426) has the molecular formula C26H50O7Si and a molecular weight of 502.77 g/mol. Its IUPAC name is 2-[(2R,3S,4S,6R)-6-[(4R,5S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methyloxan-2-yl]ethanol.
| Compound Name | 2-[(2R,3S,4S,6R)-6-[(4R,5S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methyloxan-2-yl]ethanol |
|---|---|
| PubChem CID | 11752426 |
| Molecular Formula | C26H50O7Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 2-[(2R,3S,4S,6R)-6-[(4R,5S)-5-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)-3-methyloxan-2-yl]ethanol |
| SMILES | COCO[C@H]1C[C@H]([C@H]2OC(C)(C)O[C@H]2/C=C/CCCO[Si](C)(C)C(C)(C)C)O[C@H](CCO)[C@@H]1C |
| InChI | InChI=1S/C26H50O7Si/c1-19-20(14-15-27)31-23(17-22(19)29-18-28-7)24-21(32-26(5,6)33-24)13-11-10-12-16-30-34(8,9)25(2,3)4/h11,13,19-24,27H,10,12,14-18H2,1-9H3/b13-11+/t19-,20+,21-,22-,23+,24-/m0/s1 |
| InChIKey | IOZUDXDZJVDVOF-VYBGHMRASA-N |
| XLogP | 5.03 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|