C27H54O8Si2 — CID 11753348
1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 5-O-methyl (2S,3S)-2,3-dimethylpentanedioate (PubChem CID 11753348) has the molecular formula C27H54O8Si2 and a molecular weight of 562.89 g/mol. Its IUPAC name is 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 5-O-methyl (2S,3S)-2,3-dimethylpentanedioate.
| Compound Name | 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 5-O-methyl (2S,3S)-2,3-dimethylpentanedioate |
|---|---|
| PubChem CID | 11753348 |
| Molecular Formula | C27H54O8Si2 |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | 1-O-[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 5-O-methyl (2S,3S)-2,3-dimethylpentanedioate |
| SMILES | COC(=O)C[C@H](C)[C@H](C)C(=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)O[C@@H]1C |
| InChI | InChI=1S/C27H54O8Si2/c1-17(16-20(28)30-10)18(2)24(29)33-21-19(3)32-25(31-11)23(35-37(14,15)27(7,8)9)22(21)34-36(12,13)26(4,5)6/h17-19,21-23,25H,16H2,1-15H3/t17-,18-,19+,21+,22-,23+,25-/m0/s1 |
| InChIKey | BDNCGBMRGCNTPL-YSSLXATGSA-N |
| XLogP | 5.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|