C27H56O6Si2 — CID 135000137
[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3S)-3,4,4-trimethylpentanoate (PubChem CID 135000137) has the molecular formula C27H56O6Si2 and a molecular weight of 532.91 g/mol. Its IUPAC name is [4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3S)-3,4,4-trimethylpentanoate.
| Compound Name | [4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3S)-3,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 135000137 |
| Molecular Formula | C27H56O6Si2 |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | [4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3S)-3,4,4-trimethylpentanoate |
| SMILES | COC1OC(C)C(OC(=O)C[C@H](C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O6Si2/c1-18(25(3,4)5)17-20(28)31-21-19(2)30-24(29-12)23(33-35(15,16)27(9,10)11)22(21)32-34(13,14)26(6,7)8/h18-19,21-24H,17H2,1-16H3/t18-,19?,21?,22?,23?,24?/m0/s1 |
| InChIKey | RGBCCCFVJSEKQR-DPSAPUFTSA-N |
| XLogP | 7.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|