C24H48O7Si2 — CID 134835537
[(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 2-methyl-3-oxobutanoate (PubChem CID 134835537) has the molecular formula C24H48O7Si2 and a molecular weight of 504.81 g/mol. Its IUPAC name is [(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 2-methyl-3-oxobutanoate.
| Compound Name | [(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 134835537 |
| Molecular Formula | C24H48O7Si2 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | [(3R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] 2-methyl-3-oxobutanoate |
| SMILES | CO[C@H]1OC(C)[C@@H](OC(=O)C(C)C(C)=O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O7Si2/c1-15(16(2)25)21(26)29-18-17(3)28-22(27-10)20(31-33(13,14)24(7,8)9)19(18)30-32(11,12)23(4,5)6/h15,17-20,22H,1-14H3/t15?,17?,18-,19?,20?,22+/m1/s1 |
| InChIKey | VPNANEWEDDJMNT-SNSNTUEWSA-N |
| XLogP | 5.30 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|