C21H32O12 — CID 539472
methyl 4-methyl-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoate (PubChem CID 539472) has the molecular formula C21H32O12 and a molecular weight of 476.48 g/mol. Its IUPAC name is methyl 4-methyl-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoate.
| Compound Name | methyl 4-methyl-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 539472 |
| Molecular Formula | C21H32O12 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | methyl 4-methyl-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoate |
| SMILES | COC(=O)CCC(C)COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H32O12/c1-11(7-8-17(26)27-6)9-29-21-20(32-15(5)25)19(31-14(4)24)18(30-13(3)23)16(33-21)10-28-12(2)22/h11,16,18-21H,7-10H2,1-6H3 |
| InChIKey | ZMDFGQDWBBLCGT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|