C26H32Cl3NO5Si — CID 11753441
[(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 11753441) has the molecular formula C26H32Cl3NO5Si and a molecular weight of 572.99 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11753441 |
| Molecular Formula | C26H32Cl3NO5Si |
| Molecular Weight | 572.99 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | [(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H32Cl3NO5Si/c1-24(2,3)36(17-12-8-6-9-13-17,18-14-10-7-11-15-18)31-16-19-20-21(35-25(4,5)34-20)22(32-19)33-23(30)26(27,28)29/h6-15,19-22,30H,16H2,1-5H3/b30-23+/t19-,20-,21-,22+/m1/s1 |
| InChIKey | NMVUKJOOEPOVPI-JFKLAXQQSA-N |
| XLogP | 5.17 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|