C30H36Cl3NO9Si — CID 10952563
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 10952563) has the molecular formula C30H36Cl3NO9Si and a molecular weight of 689.06 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10952563 |
| Molecular Formula | C30H36Cl3NO9Si |
| Molecular Weight | 689.06 g/mol |
| Exact Mass | 687.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H36Cl3NO9Si/c1-18(35)39-24-23(42-27(43-28(34)30(31,32)33)26(41-20(3)37)25(24)40-19(2)36)17-38-44(29(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-27,34H,17H2,1-6H3/b34-28+/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | KQDWHZHQFXBDSS-QWCUQHGYSA-N |
| XLogP | 4.45 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.06 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|