C24H30ClNO5Si — CID 134845229
[(3aR,5R)-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 134845229) has the molecular formula C24H30ClNO5Si and a molecular weight of 476.05 g/mol. Its IUPAC name is [(3aR,5R)-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5R)-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134845229 |
| Molecular Formula | C24H30ClNO5Si |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [(3aR,5R)-6-chloro-2,2-dimethyl-6-nitroso-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)OC2[C@H](O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2(Cl)N=O)O1 |
| InChI | InChI=1S/C24H30ClNO5Si/c1-22(2,3)32(17-12-8-6-9-13-17,18-14-10-7-11-15-18)28-16-19-24(25,26-27)20-21(29-19)31-23(4,5)30-20/h6-15,19-21H,16H2,1-5H3/t19-,20?,21-,24?/m1/s1 |
| InChIKey | PTSPISQPUVFDOP-LXEVQABCSA-N |
| XLogP | 4.14 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|