About 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate
2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate (PubChem CID 11754617) has the molecular formula C20H44NO7PS
and a molecular weight of 473.61 g/mol. Its IUPAC name is 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate.
Molecular Properties
| Compound Name | 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate |
| PubChem CID | 11754617 |
| Molecular Formula | C20H44NO7PS |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate |
| SMILES | CCCCCCCCCCS(=O)(=O)NC(CCCCCC)COP(=O)(O)OCCO |
| InChI | InChI=1S/C20H44NO7PS/c1-3-5-7-9-10-11-12-14-18-30(25,26)21-20(15-13-8-6-4-2)19-28-29(23,24)27-17-16-22/h20-22H,3-19H2,1-2H3,(H,23,24) |
| InChIKey | ZLUMQIJOEAYEOS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate?
The IUPAC name of 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate (CID 11754617) is 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate.
What is the SMILES notation for 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate?
The canonical SMILES for 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate is CCCCCCCCCCS(=O)(=O)NC(CCCCCC)COP(=O)(O)OCCO.
What is the InChIKey of 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate?
The InChIKey is ZLUMQIJOEAYEOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44NO7PS/c1-3-5-7-9-10-11-12-14-18-30(25,26)21-20(15-13-8-6-4-2)19-28-29(23,24)27-17-16-22/h20-22H,3-19H2,1-2H3,(H,23,24).
What are the key properties of 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate?
2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate has a molecular weight of 473.61 g/mol, XLogP of 4.51, 22 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(decylsulfonylamino)octyl 2-hydroxyethyl hydrogen phosphate is sourced from PubChem (CID 11754617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).