C26H30N2O5S — CID 11755002
methyl (4aR,11cR)-4a-ethyl-7-(4-methoxyphenyl)sulfonyl-2,3,4,5,6,11c-hexahydropyrido[3,2-c]carbazole-1-carboxylate (PubChem CID 11755002) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is methyl (4aR,11cR)-4a-ethyl-7-(4-methoxyphenyl)sulfonyl-2,3,4,5,6,11c-hexahydropyrido[3,2-c]carbazole-1-carboxylate.
| Compound Name | methyl (4aR,11cR)-4a-ethyl-7-(4-methoxyphenyl)sulfonyl-2,3,4,5,6,11c-hexahydropyrido[3,2-c]carbazole-1-carboxylate |
|---|---|
| PubChem CID | 11755002 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | methyl (4aR,11cR)-4a-ethyl-7-(4-methoxyphenyl)sulfonyl-2,3,4,5,6,11c-hexahydropyrido[3,2-c]carbazole-1-carboxylate |
| SMILES | CC[C@]12CCCN(C(=O)OC)[C@H]1c1c(n(S(=O)(=O)c3ccc(OC)cc3)c3ccccc13)CC2 |
| InChI | InChI=1S/C26H30N2O5S/c1-4-26-15-7-17-27(25(29)33-3)24(26)23-20-8-5-6-9-21(20)28(22(23)14-16-26)34(30,31)19-12-10-18(32-2)11-13-19/h5-6,8-13,24H,4,7,14-17H2,1-3H3/t24-,26+/m0/s1 |
| InChIKey | UAJBXCZRYWARMK-AZGAKELHSA-N |
| XLogP | 5.13 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |