C22H25N3O7S2 — CID 18784568
2-[[2-[2-(4-methoxyphenyl)sulfonyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetyl]amino]ethanesulfonic acid (PubChem CID 18784568) has the molecular formula C22H25N3O7S2 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-[[2-[2-(4-methoxyphenyl)sulfonyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[2-(4-methoxyphenyl)sulfonyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 18784568 |
| Molecular Formula | C22H25N3O7S2 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 2-[[2-[2-(4-methoxyphenyl)sulfonyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetyl]amino]ethanesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3c(n(CC(=O)NCCS(=O)(=O)O)c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C22H25N3O7S2/c1-32-16-6-8-17(9-7-16)34(30,31)24-12-10-19-18-4-2-3-5-20(18)25(21(19)14-24)15-22(26)23-11-13-33(27,28)29/h2-9H,10-15H2,1H3,(H,23,26)(H,27,28,29) |
| InChIKey | HJUZYIORNLDYPA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|