C26H29ClN2O3S — CID 11755105
4-[[3-chloro-5-(cyclopentanecarbonylamino)-2-(propylsulfanylmethyl)indol-1-yl]methyl]benzoic acid (PubChem CID 11755105) has the molecular formula C26H29ClN2O3S and a molecular weight of 485.05 g/mol. Its IUPAC name is 4-[[3-chloro-5-(cyclopentanecarbonylamino)-2-(propylsulfanylmethyl)indol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-chloro-5-(cyclopentanecarbonylamino)-2-(propylsulfanylmethyl)indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 11755105 |
| Molecular Formula | C26H29ClN2O3S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 4-[[3-chloro-5-(cyclopentanecarbonylamino)-2-(propylsulfanylmethyl)indol-1-yl]methyl]benzoic acid |
| SMILES | CCCSCc1c(Cl)c2cc(NC(=O)C3CCCC3)ccc2n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H29ClN2O3S/c1-2-13-33-16-23-24(27)21-14-20(28-25(30)18-5-3-4-6-18)11-12-22(21)29(23)15-17-7-9-19(10-8-17)26(31)32/h7-12,14,18H,2-6,13,15-16H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | KGAPUNTUJWYKNH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|