C27H28ClN3O — CID 43926053
1-[(4-chlorophenyl)methyl]-N-(9-ethylcarbazol-3-yl)piperidine-3-carboxamide (PubChem CID 43926053) has the molecular formula C27H28ClN3O and a molecular weight of 445.99 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(9-ethylcarbazol-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(9-ethylcarbazol-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43926053 |
| Molecular Formula | C27H28ClN3O |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(9-ethylcarbazol-3-yl)piperidine-3-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)C3CCCN(Cc4ccc(Cl)cc4)C3)ccc21 |
| InChI | InChI=1S/C27H28ClN3O/c1-2-31-25-8-4-3-7-23(25)24-16-22(13-14-26(24)31)29-27(32)20-6-5-15-30(18-20)17-19-9-11-21(28)12-10-19/h3-4,7-14,16,20H,2,5-6,15,17-18H2,1H3,(H,29,32) |
| InChIKey | QEIFTXTYGYXJFZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |