C33H36N2O3 — CID 11756002
N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenyl-N-(2-pyridin-2-ylethyl)pentanamide (PubChem CID 11756002) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenyl-N-(2-pyridin-2-ylethyl)pentanamide.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenyl-N-(2-pyridin-2-ylethyl)pentanamide |
|---|---|
| PubChem CID | 11756002 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phenyl-N-(2-pyridin-2-ylethyl)pentanamide |
| SMILES | COc1cc(CN(CCc2ccccn2)C(=O)CCC(C)c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H36N2O3/c1-26(29-13-7-4-8-14-29)16-19-33(36)35(22-20-30-15-9-10-21-34-30)24-28-17-18-31(32(23-28)37-2)38-25-27-11-5-3-6-12-27/h3-15,17-18,21,23,26H,16,19-20,22,24-25H2,1-2H3 |
| InChIKey | CUZHJFRQOSBMFW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |