C26H34O12 — CID 11757149
4-O-methyl 3-O,5-O-bis(trideuteriomethyl) (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 11757149) has the molecular formula C26H34O12 and a molecular weight of 544.58 g/mol. Its IUPAC name is 4-O-methyl 3-O,5-O-bis(trideuteriomethyl) (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | 4-O-methyl 3-O,5-O-bis(trideuteriomethyl) (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 11757149 |
| Molecular Formula | C26H34O12 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 4-O-methyl 3-O,5-O-bis(trideuteriomethyl) (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | [2H]C([2H])([2H])OC(=O)[C@H]1O[C@@]2(CCC(=C)C(O)C(C)Cc3ccccc3)O[C@](C(=O)OC([2H])([2H])[2H])([C@H](O)[C@H]2O)[C@]1(O)C(=O)OC |
| InChI | InChI=1S/C26H34O12/c1-14(17(27)15(2)13-16-9-7-6-8-10-16)11-12-24-18(28)19(29)26(38-24,23(32)36-5)25(33,22(31)35-4)20(37-24)21(30)34-3/h6-10,15,17-20,27-29,33H,1,11-13H2,2-5H3/t15?,17?,18-,19-,20-,24+,25-,26+/m1/s1/i3D3,5D3 |
| InChIKey | JOMXWWVMXZYQSE-PVOJSRHNSA-N |
| XLogP | -0.60 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|