C39H44O13 — CID 134956110
trimethyl (6R,7R)-6-benzoyloxy-4,7-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 134956110) has the molecular formula C39H44O13 and a molecular weight of 720.77 g/mol. Its IUPAC name is trimethyl (6R,7R)-6-benzoyloxy-4,7-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | trimethyl (6R,7R)-6-benzoyloxy-4,7-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 134956110 |
| Molecular Formula | C39H44O13 |
| Molecular Weight | 720.77 g/mol |
| Exact Mass | 720.28 |
| IUPAC Name | trimethyl (6R,7R)-6-benzoyloxy-4,7-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1OC2(CCC[C@@H](OCc3ccccc3)[C@H](C)Cc3ccccc3)OC(C(=O)OC)([C@H](OC(=O)c3ccccc3)[C@H]2O)C1(O)C(=O)OC |
| InChI | InChI=1S/C39H44O13/c1-25(23-26-15-8-5-9-16-26)29(49-24-27-17-10-6-11-18-27)21-14-22-37-30(40)31(50-33(41)28-19-12-7-13-20-28)39(52-37,36(44)48-4)38(45,35(43)47-3)32(51-37)34(42)46-2/h5-13,15-20,25,29-32,40,45H,14,21-24H2,1-4H3/t25-,29-,30-,31-,32?,37?,38?,39?/m1/s1 |
| InChIKey | HLWZWIJGQPARAL-XEEIEEGGSA-N |
| XLogP | 3.32 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|