C23H30O12 — CID 67755352
4,6,7-trihydroxy-1-(4-hydroxy-3,5-dimethyl-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67755352) has the molecular formula C23H30O12 and a molecular weight of 498.48 g/mol. Its IUPAC name is 4,6,7-trihydroxy-1-(4-hydroxy-3,5-dimethyl-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 4,6,7-trihydroxy-1-(4-hydroxy-3,5-dimethyl-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67755352 |
| Molecular Formula | C23H30O12 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 4,6,7-trihydroxy-1-(4-hydroxy-3,5-dimethyl-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | CC(CCC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(O)C2O)C(O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H30O12/c1-11(14(24)12(2)10-13-6-4-3-5-7-13)8-9-21-15(25)16(26)23(35-21,20(31)32)22(33,19(29)30)17(34-21)18(27)28/h3-7,11-12,14-17,24-26,33H,8-10H2,1-2H3,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | BEMCKMMIOXGFEF-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 211.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |