C23H28O11 — CID 67905826
1-[(E)-3,5-dimethyl-6-phenylhex-2-enyl]-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67905826) has the molecular formula C23H28O11 and a molecular weight of 480.47 g/mol. Its IUPAC name is 1-[(E)-3,5-dimethyl-6-phenylhex-2-enyl]-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 1-[(E)-3,5-dimethyl-6-phenylhex-2-enyl]-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67905826 |
| Molecular Formula | C23H28O11 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 1-[(E)-3,5-dimethyl-6-phenylhex-2-enyl]-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C/C(=C\CC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(O)C2O)CC(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H28O11/c1-12(10-13(2)11-14-6-4-3-5-7-14)8-9-21-15(24)16(25)23(34-21,20(30)31)22(32,19(28)29)17(33-21)18(26)27/h3-8,13,15-17,24-25,32H,9-11H2,1-2H3,(H,26,27)(H,28,29)(H,30,31)/b12-8+ |
| InChIKey | UHFUMRFGCFEGMS-XYOKQWHBSA-N |
| XLogP | 0.16 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|