C23H28O12 — CID 162992442
(1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-[(Z,5S)-3-(hydroxymethyl)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 162992442) has the molecular formula C23H28O12 and a molecular weight of 496.47 g/mol. Its IUPAC name is (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-[(Z,5S)-3-(hydroxymethyl)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-[(Z,5S)-3-(hydroxymethyl)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 162992442 |
| Molecular Formula | C23H28O12 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (1S,3S,4S,5R,6R,7R)-4,6,7-trihydroxy-1-[(Z,5S)-3-(hydroxymethyl)-5-methyl-6-phenylhex-3-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C[C@H](/C=C(\CO)CC[C@]12O[C@H](C(=O)O)[C@@](O)(C(=O)O)[C@](C(=O)O)(O1)[C@H](O)[C@H]2O)Cc1ccccc1 |
| InChI | InChI=1S/C23H28O12/c1-12(9-13-5-3-2-4-6-13)10-14(11-24)7-8-21-15(25)16(26)23(35-21,20(31)32)22(33,19(29)30)17(34-21)18(27)28/h2-6,10,12,15-17,24-26,33H,7-9,11H2,1H3,(H,27,28)(H,29,30)(H,31,32)/b14-10-/t12-,15+,16+,17+,21-,22+,23-/m0/s1 |
| InChIKey | NNOAULQCFAVIGM-DLQFKUPVSA-N |
| XLogP | -0.87 |
| TPSA | 211.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|