C24H30O12 — CID 67756153
1-(3-ethyl-5-methyl-4-oxo-6-phenylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67756153) has the molecular formula C24H30O12 and a molecular weight of 510.49 g/mol. Its IUPAC name is 1-(3-ethyl-5-methyl-4-oxo-6-phenylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 1-(3-ethyl-5-methyl-4-oxo-6-phenylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67756153 |
| Molecular Formula | C24H30O12 |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 1-(3-ethyl-5-methyl-4-oxo-6-phenylhexyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | CCC(CCC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(O)C2O)C(=O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H30O12/c1-3-14(15(25)12(2)11-13-7-5-4-6-8-13)9-10-22-16(26)17(27)24(36-22,21(32)33)23(34,20(30)31)18(35-22)19(28)29/h4-8,12,14,16-18,26-27,34H,3,9-11H2,1-2H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | GYIFFXCKAKLKDQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |