C22H24O12 — CID 67905769
4,6,7-trihydroxy-1-[(E)-3-methyl-4-oxo-6-phenylhex-2-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 67905769) has the molecular formula C22H24O12 and a molecular weight of 480.42 g/mol. Its IUPAC name is 4,6,7-trihydroxy-1-[(E)-3-methyl-4-oxo-6-phenylhex-2-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 4,6,7-trihydroxy-1-[(E)-3-methyl-4-oxo-6-phenylhex-2-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 67905769 |
| Molecular Formula | C22H24O12 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 4,6,7-trihydroxy-1-[(E)-3-methyl-4-oxo-6-phenylhex-2-enyl]-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C/C(=C\CC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(O)C2O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C22H24O12/c1-11(13(23)8-7-12-5-3-2-4-6-12)9-10-20-14(24)15(25)22(34-20,19(30)31)21(32,18(28)29)16(33-20)17(26)27/h2-6,9,14-16,24-25,32H,7-8,10H2,1H3,(H,26,27)(H,28,29)(H,30,31)/b11-9+ |
| InChIKey | DRGPUGLSRICCRR-PKNBQFBNSA-N |
| XLogP | -0.90 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|