C17H29NO2S — CID 11758751
(3S)-3-[[(R)-[2-[(1S)-1-(dimethylamino)ethyl]phenyl]sulfinyl]methyl]-2-methylpentan-3-ol (PubChem CID 11758751) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is (3S)-3-[[(R)-[2-[(1S)-1-(dimethylamino)ethyl]phenyl]sulfinyl]methyl]-2-methylpentan-3-ol.
| Compound Name | (3S)-3-[[(R)-[2-[(1S)-1-(dimethylamino)ethyl]phenyl]sulfinyl]methyl]-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 11758751 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (3S)-3-[[(R)-[2-[(1S)-1-(dimethylamino)ethyl]phenyl]sulfinyl]methyl]-2-methylpentan-3-ol |
| SMILES | CC[C@@](O)(C[S@@](=O)c1ccccc1[C@H](C)N(C)C)C(C)C |
| InChI | InChI=1S/C17H29NO2S/c1-7-17(19,13(2)3)12-21(20)16-11-9-8-10-15(16)14(4)18(5)6/h8-11,13-14,19H,7,12H2,1-6H3/t14-,17+,21+/m0/s1 |
| InChIKey | FHTDTCUQJXCQSW-AVBTWRTFSA-N |
| XLogP | 3.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |