C11H17NSe — CID 134865644
(1S)-N,N-dimethyl-1-(2-methylselanylphenyl)ethanamine (PubChem CID 134865644) has the molecular formula C11H17NSe and a molecular weight of 242.22 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-(2-methylselanylphenyl)ethanamine.
| Compound Name | (1S)-N,N-dimethyl-1-(2-methylselanylphenyl)ethanamine |
|---|---|
| PubChem CID | 134865644 |
| Molecular Formula | C11H17NSe |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (1S)-N,N-dimethyl-1-(2-methylselanylphenyl)ethanamine |
| SMILES | C[Se]c1ccccc1[C@H](C)N(C)C |
| InChI | InChI=1S/C11H17NSe/c1-9(12(2)3)10-7-5-6-8-11(10)13-4/h5-9H,1-4H3/t9-/m0/s1 |
| InChIKey | PJCVGHCPUMINMV-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|