C14H17CrNO3S — CID 85409782
carbon monoxide;chromium;N,N-dimethyl-1-(2-methylsulfanylphenyl)ethanamine (PubChem CID 85409782) has the molecular formula C14H17CrNO3S and a molecular weight of 331.36 g/mol. Its IUPAC name is carbon monoxide;chromium;N,N-dimethyl-1-(2-methylsulfanylphenyl)ethanamine.
| Compound Name | carbon monoxide;chromium;N,N-dimethyl-1-(2-methylsulfanylphenyl)ethanamine |
|---|---|
| PubChem CID | 85409782 |
| Molecular Formula | C14H17CrNO3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | carbon monoxide;chromium;N,N-dimethyl-1-(2-methylsulfanylphenyl)ethanamine |
| SMILES | CSc1ccccc1C(C)N(C)C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C11H17NS.3CO.Cr/c1-9(12(2)3)10-7-5-6-8-11(10)13-4;3*1-2;/h5-9H,1-4H3;;;; |
| InChIKey | LNHSGMJWFPOPLI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|