C13H19NOS — CID 101208343
(1R)-N,N-dimethyl-1-(2-prop-2-enylsulfinylphenyl)ethanamine (PubChem CID 101208343) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-1-(2-prop-2-enylsulfinylphenyl)ethanamine.
| Compound Name | (1R)-N,N-dimethyl-1-(2-prop-2-enylsulfinylphenyl)ethanamine |
|---|---|
| PubChem CID | 101208343 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (1R)-N,N-dimethyl-1-(2-prop-2-enylsulfinylphenyl)ethanamine |
| SMILES | C=CCS(=O)c1ccccc1[C@@H](C)N(C)C |
| InChI | InChI=1S/C13H19NOS/c1-5-10-16(15)13-9-7-6-8-12(13)11(2)14(3)4/h5-9,11H,1,10H2,2-4H3/t11-,16?/m1/s1 |
| InChIKey | GNDZFELHHSRUEN-ZVDHGWRTSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|