C24H33NO2 — CID 11760351
(2S,4R,5R)-2-(dibenzylamino)-5-hydroxy-4,6,6-trimethylheptan-3-one (PubChem CID 11760351) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (2S,4R,5R)-2-(dibenzylamino)-5-hydroxy-4,6,6-trimethylheptan-3-one.
| Compound Name | (2S,4R,5R)-2-(dibenzylamino)-5-hydroxy-4,6,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 11760351 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (2S,4R,5R)-2-(dibenzylamino)-5-hydroxy-4,6,6-trimethylheptan-3-one |
| SMILES | C[C@@H](C(=O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C24H33NO2/c1-18(23(27)24(3,4)5)22(26)19(2)25(16-20-12-8-6-9-13-20)17-21-14-10-7-11-15-21/h6-15,18-19,23,27H,16-17H2,1-5H3/t18-,19-,23+/m0/s1 |
| InChIKey | GWSFDRJDYNOQMM-SFYKDHMMSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |