C22H22F2N2O4S2 — CID 11762574
7,14-bis(4-fluorophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide (PubChem CID 11762574) has the molecular formula C22H22F2N2O4S2 and a molecular weight of 480.56 g/mol. Its IUPAC name is 7,14-bis(4-fluorophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide.
| Compound Name | 7,14-bis(4-fluorophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide |
|---|---|
| PubChem CID | 11762574 |
| Molecular Formula | C22H22F2N2O4S2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 7,14-bis(4-fluorophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide |
| SMILES | O=S1(=O)CC2C(C1)N1C(c3ccc(F)cc3)C3CS(=O)(=O)CC3N1C2c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F2N2O4S2/c23-15-5-1-13(2-6-15)21-17-9-31(27,28)11-19(17)26-22(14-3-7-16(24)8-4-14)18-10-32(29,30)12-20(18)25(21)26/h1-8,17-22H,9-12H2 |
| InChIKey | VBFPXJMEOSHEPY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |