C23H15Br2NO4 — CID 11763161
2,6-bis[(E)-2-(2-bromophenyl)ethenyl]pyridine-3,5-dicarboxylic acid (PubChem CID 11763161) has the molecular formula C23H15Br2NO4 and a molecular weight of 529.18 g/mol. Its IUPAC name is 2,6-bis[(E)-2-(2-bromophenyl)ethenyl]pyridine-3,5-dicarboxylic acid.
| Compound Name | 2,6-bis[(E)-2-(2-bromophenyl)ethenyl]pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 11763161 |
| Molecular Formula | C23H15Br2NO4 |
| Molecular Weight | 529.18 g/mol |
| Exact Mass | 526.94 |
| IUPAC Name | 2,6-bis[(E)-2-(2-bromophenyl)ethenyl]pyridine-3,5-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(/C=C/c2ccccc2Br)nc1/C=C/c1ccccc1Br |
| InChI | InChI=1S/C23H15Br2NO4/c24-18-7-3-1-5-14(18)9-11-20-16(22(27)28)13-17(23(29)30)21(26-20)12-10-15-6-2-4-8-19(15)25/h1-13H,(H,27,28)(H,29,30)/b11-9+,12-10+ |
| InChIKey | RNJHLJHEPWCLOQ-WGDLNXRISA-N |
| XLogP | 6.34 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.18 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |